C22H22FNO3 — CID 123292841
7-[5-(2-fluorophenyl)-4-phenyl-1,3-oxazol-2-yl]heptanoic acid (PubChem CID 123292841) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is 7-[5-(2-fluorophenyl)-4-phenyl-1,3-oxazol-2-yl]heptanoic acid.
| Compound Name | 7-[5-(2-fluorophenyl)-4-phenyl-1,3-oxazol-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 123292841 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 7-[5-(2-fluorophenyl)-4-phenyl-1,3-oxazol-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1nc(-c2ccccc2)c(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H22FNO3/c23-18-13-9-8-12-17(18)22-21(16-10-4-3-5-11-16)24-19(27-22)14-6-1-2-7-15-20(25)26/h3-5,8-13H,1-2,6-7,14-15H2,(H,25,26) |
| InChIKey | YJTICOLLIDHBBY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|