C25H23FN2O3 — CID 118518775
5-(2-fluorophenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide (PubChem CID 118518775) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 118518775 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 5-(2-fluorophenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide |
| SMILES | O=C(NCCCCCc1ccccc1)n1c(=O)oc2ccc(-c3ccccc3F)cc21 |
| InChI | InChI=1S/C25H23FN2O3/c26-21-13-7-6-12-20(21)19-14-15-23-22(17-19)28(25(30)31-23)24(29)27-16-8-2-5-11-18-9-3-1-4-10-18/h1,3-4,6-7,9-10,12-15,17H,2,5,8,11,16H2,(H,27,29) |
| InChIKey | LUGBUGPCOUMMGZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|