C27H27F3N2O3 — CID 162613230
2-oxo-N-(6-phenylhexyl)-5-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole-3-carboxamide (PubChem CID 162613230) has the molecular formula C27H27F3N2O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-oxo-N-(6-phenylhexyl)-5-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole-3-carboxamide.
| Compound Name | 2-oxo-N-(6-phenylhexyl)-5-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 162613230 |
| Molecular Formula | C27H27F3N2O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-oxo-N-(6-phenylhexyl)-5-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole-3-carboxamide |
| SMILES | O=C(NCCCCCCc1ccccc1)n1c(=O)oc2ccc(C3C=CC(C(F)(F)F)=CC3)cc21 |
| InChI | InChI=1S/C27H27F3N2O3/c28-27(29,30)22-14-11-20(12-15-22)21-13-16-24-23(18-21)32(26(34)35-24)25(33)31-17-7-2-1-4-8-19-9-5-3-6-10-19/h3,5-6,9-11,13-16,18,20H,1-2,4,7-8,12,17H2,(H,31,33) |
| InChIKey | UZVXQZGVJBGOHA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|