C18H17N3O5 — CID 118513794
5-nitro-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide (PubChem CID 118513794) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 5-nitro-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide.
| Compound Name | 5-nitro-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 118513794 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-nitro-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)n1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H17N3O5/c22-17(19-11-5-4-8-13-6-2-1-3-7-13)20-15-12-14(21(24)25)9-10-16(15)26-18(20)23/h1-3,6-7,9-10,12H,4-5,8,11H2,(H,19,22) |
| InChIKey | ZVMODDKUBIKYMJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|