C22H27ClN4O3 — CID 155522026
2-oxo-N-(4-phenylbutyl)-6-piperazin-1-yl-1,3-benzoxazole-3-carboxamide;hydrochloride (PubChem CID 155522026) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 2-oxo-N-(4-phenylbutyl)-6-piperazin-1-yl-1,3-benzoxazole-3-carboxamide;hydrochloride.
| Compound Name | 2-oxo-N-(4-phenylbutyl)-6-piperazin-1-yl-1,3-benzoxazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155522026 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-oxo-N-(4-phenylbutyl)-6-piperazin-1-yl-1,3-benzoxazole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCc1ccccc1)n1c(=O)oc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C22H26N4O3.ClH/c27-21(24-11-5-4-8-17-6-2-1-3-7-17)26-19-10-9-18(16-20(19)29-22(26)28)25-14-12-23-13-15-25;/h1-3,6-7,9-10,16,23H,4-5,8,11-15H2,(H,24,27);1H |
| InChIKey | VOWMHZJQWGXUCF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|