C27H35N3O3 — CID 175287317
2-tert-butyl-2-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(4-phenylbutyl)piperidine-1-carboxamide (PubChem CID 175287317) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-tert-butyl-2-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(4-phenylbutyl)piperidine-1-carboxamide.
| Compound Name | 2-tert-butyl-2-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(4-phenylbutyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 175287317 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-tert-butyl-2-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(4-phenylbutyl)piperidine-1-carboxamide |
| SMILES | CC(C)(C)C1(c2ccc3[nH]c(=O)oc3c2)CCCCN1C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C27H35N3O3/c1-26(2,3)27(21-14-15-22-23(19-21)33-25(32)29-22)16-8-10-18-30(27)24(31)28-17-9-7-13-20-11-5-4-6-12-20/h4-6,11-12,14-15,19H,7-10,13,16-18H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | JBMYSXKAQSJRLU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|