C17H27N3 — CID 110935446
N'-methyl-N-(5-phenylpentyl)pyrrolidine-1-carboximidamide (PubChem CID 110935446) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N'-methyl-N-(5-phenylpentyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(5-phenylpentyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110935446 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N'-methyl-N-(5-phenylpentyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCCCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C17H27N3/c1-18-17(20-14-8-9-15-20)19-13-7-3-6-12-16-10-4-2-5-11-16/h2,4-5,10-11H,3,6-9,12-15H2,1H3,(H,18,19) |
| InChIKey | PCRFJDWUFHUIAQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|