C16H24BrN3S — CID 111414899
N-[4-(2-bromophenyl)sulfanylbutyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111414899) has the molecular formula C16H24BrN3S and a molecular weight of 370.36 g/mol. Its IUPAC name is N-[4-(2-bromophenyl)sulfanylbutyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[4-(2-bromophenyl)sulfanylbutyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111414899 |
| Molecular Formula | C16H24BrN3S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[4-(2-bromophenyl)sulfanylbutyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCCSc1ccccc1Br)N1CCCC1 |
| InChI | InChI=1S/C16H24BrN3S/c1-18-16(20-11-5-6-12-20)19-10-4-7-13-21-15-9-3-2-8-14(15)17/h2-3,8-9H,4-7,10-13H2,1H3,(H,18,19) |
| InChIKey | YGNHVEFUBXOOAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|