C18H20BrNO2S — CID 122031573
4-[[4-(2-bromophenyl)sulfanylbutylamino]methyl]benzoic acid (PubChem CID 122031573) has the molecular formula C18H20BrNO2S and a molecular weight of 394.33 g/mol. Its IUPAC name is 4-[[4-(2-bromophenyl)sulfanylbutylamino]methyl]benzoic acid.
| Compound Name | 4-[[4-(2-bromophenyl)sulfanylbutylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031573 |
| Molecular Formula | C18H20BrNO2S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[[4-(2-bromophenyl)sulfanylbutylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCCCSc2ccccc2Br)cc1 |
| InChI | InChI=1S/C18H20BrNO2S/c19-16-5-1-2-6-17(16)23-12-4-3-11-20-13-14-7-9-15(10-8-14)18(21)22/h1-2,5-10,20H,3-4,11-13H2,(H,21,22) |
| InChIKey | XMSFHPZOUNXMCK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|