C17H18ClNO2S — CID 71156608
2-[3-[(4-chlorophenyl)methylamino]propylsulfanyl]benzoic acid (PubChem CID 71156608) has the molecular formula C17H18ClNO2S and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methylamino]propylsulfanyl]benzoic acid.
| Compound Name | 2-[3-[(4-chlorophenyl)methylamino]propylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 71156608 |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methylamino]propylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SCCCNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO2S/c18-14-8-6-13(7-9-14)12-19-10-3-11-22-16-5-2-1-4-15(16)17(20)21/h1-2,4-9,19H,3,10-12H2,(H,20,21) |
| InChIKey | ALADXHPOSIXTNA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|