C17H25NO2 — CID 122031644
4-[(4-cyclopentylbutylamino)methyl]benzoic acid (PubChem CID 122031644) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-[(4-cyclopentylbutylamino)methyl]benzoic acid.
| Compound Name | 4-[(4-cyclopentylbutylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 122031644 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-[(4-cyclopentylbutylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCCCC2CCCC2)cc1 |
| InChI | InChI=1S/C17H25NO2/c19-17(20)16-10-8-15(9-11-16)13-18-12-4-3-7-14-5-1-2-6-14/h8-11,14,18H,1-7,12-13H2,(H,19,20) |
| InChIKey | DSJGTIFVQNBVLO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|