C15H21NO3 — CID 64912854
4-[[(2-hydroxycyclohexyl)methylamino]methyl]benzoic acid (PubChem CID 64912854) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[[(2-hydroxycyclohexyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-hydroxycyclohexyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 64912854 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-[[(2-hydroxycyclohexyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCC2CCCCC2O)cc1 |
| InChI | InChI=1S/C15H21NO3/c17-14-4-2-1-3-13(14)10-16-9-11-5-7-12(8-6-11)15(18)19/h5-8,13-14,16-17H,1-4,9-10H2,(H,18,19) |
| InChIKey | SQSRGHLHUCLHOA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |