C16H22N2O4 — CID 122019975
4-[[[(1R,2S)-2-hydroxycyclohexyl]methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122019975) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-[[[(1R,2S)-2-hydroxycyclohexyl]methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(1R,2S)-2-hydroxycyclohexyl]methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019975 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-[[[(1R,2S)-2-hydroxycyclohexyl]methylcarbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)cc1)NC[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H22N2O4/c19-14-4-2-1-3-13(14)10-18-16(22)17-9-11-5-7-12(8-6-11)15(20)21/h5-8,13-14,19H,1-4,9-10H2,(H,20,21)(H2,17,18,22)/t13-,14+/m1/s1 |
| InChIKey | DKMSGONYHQVVNB-KGLIPLIRSA-N |
| XLogP | 1.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |