C15H20N2O5S — CID 122009613
4-[[(1,1-dioxothian-2-yl)methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122009613) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[(1,1-dioxothian-2-yl)methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(1,1-dioxothian-2-yl)methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122009613 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[[(1,1-dioxothian-2-yl)methylcarbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)cc1)NCC1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H20N2O5S/c18-14(19)12-6-4-11(5-7-12)9-16-15(20)17-10-13-3-1-2-8-23(13,21)22/h4-7,13H,1-3,8-10H2,(H,18,19)(H2,16,17,20) |
| InChIKey | ARFIETNMJXGPSW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |