C17H23N3O4 — CID 122020332
4-[[3-(cyclobutanecarbonylamino)propylcarbamoylamino]methyl]benzoic acid (PubChem CID 122020332) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[[3-(cyclobutanecarbonylamino)propylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[3-(cyclobutanecarbonylamino)propylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020332 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[[3-(cyclobutanecarbonylamino)propylcarbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCCCNC(=O)C1CCC1)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H23N3O4/c21-15(13-3-1-4-13)18-9-2-10-19-17(24)20-11-12-5-7-14(8-6-12)16(22)23/h5-8,13H,1-4,9-11H2,(H,18,21)(H,22,23)(H2,19,20,24) |
| InChIKey | AEOTTWMJPJERRN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|