C13H13Br2NO3 — CID 167797220
4-[[(3,3-dibromocyclobutanecarbonyl)amino]methyl]benzoic acid (PubChem CID 167797220) has the molecular formula C13H13Br2NO3 and a molecular weight of 391.06 g/mol. Its IUPAC name is 4-[[(3,3-dibromocyclobutanecarbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3,3-dibromocyclobutanecarbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 167797220 |
| Molecular Formula | C13H13Br2NO3 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 4-[[(3,3-dibromocyclobutanecarbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2CC(Br)(Br)C2)cc1 |
| InChI | InChI=1S/C13H13Br2NO3/c14-13(15)5-10(6-13)11(17)16-7-8-1-3-9(4-2-8)12(18)19/h1-4,10H,5-7H2,(H,16,17)(H,18,19) |
| InChIKey | QPSDFRCVCYTHIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|