C27H25FN2O3 — CID 139499620
7-(4-fluorobenzoyl)-3-[1-(5-phenylpentylamino)ethenyl]-1,3-benzoxazol-2-one (PubChem CID 139499620) has the molecular formula C27H25FN2O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is 7-(4-fluorobenzoyl)-3-[1-(5-phenylpentylamino)ethenyl]-1,3-benzoxazol-2-one.
| Compound Name | 7-(4-fluorobenzoyl)-3-[1-(5-phenylpentylamino)ethenyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 139499620 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 7-(4-fluorobenzoyl)-3-[1-(5-phenylpentylamino)ethenyl]-1,3-benzoxazol-2-one |
| SMILES | C=C(NCCCCCc1ccccc1)n1c(=O)oc2c(C(=O)c3ccc(F)cc3)cccc21 |
| InChI | InChI=1S/C27H25FN2O3/c1-19(29-18-7-3-6-11-20-9-4-2-5-10-20)30-24-13-8-12-23(26(24)33-27(30)32)25(31)21-14-16-22(28)17-15-21/h2,4-5,8-10,12-17,29H,1,3,6-7,11,18H2 |
| InChIKey | KUAAMFLRAFOEJI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|