C23H24N2O2 — CID 118402576
1-[5-[2-(methylideneamino)phenyl]-1,3-oxazol-2-yl]-7-phenylheptan-1-one (PubChem CID 118402576) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[5-[2-(methylideneamino)phenyl]-1,3-oxazol-2-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[5-[2-(methylideneamino)phenyl]-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 118402576 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-[5-[2-(methylideneamino)phenyl]-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
| SMILES | C=Nc1ccccc1-c1cnc(C(=O)CCCCCCc2ccccc2)o1 |
| InChI | InChI=1S/C23H24N2O2/c1-24-20-15-10-9-14-19(20)22-17-25-23(27-22)21(26)16-8-3-2-5-11-18-12-6-4-7-13-18/h4,6-7,9-10,12-15,17H,1-3,5,8,11,16H2 |
| InChIKey | VRUABJOZKAMSCF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|