C17H21NO2S — CID 91384708
1-(4-methylsulfanyl-1,3-oxazol-2-yl)-7-phenylheptan-2-one (PubChem CID 91384708) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(4-methylsulfanyl-1,3-oxazol-2-yl)-7-phenylheptan-2-one.
| Compound Name | 1-(4-methylsulfanyl-1,3-oxazol-2-yl)-7-phenylheptan-2-one |
|---|---|
| PubChem CID | 91384708 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-(4-methylsulfanyl-1,3-oxazol-2-yl)-7-phenylheptan-2-one |
| SMILES | CSc1coc(CC(=O)CCCCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H21NO2S/c1-21-17-13-20-16(18-17)12-15(19)11-7-3-6-10-14-8-4-2-5-9-14/h2,4-5,8-9,13H,3,6-7,10-12H2,1H3 |
| InChIKey | VOFYDFCBIHJVQA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|