C15H20N4O3 — CID 123390760
6-hydroxy-2-[2-phenyl-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid (PubChem CID 123390760) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-hydroxy-2-[2-phenyl-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid.
| Compound Name | 6-hydroxy-2-[2-phenyl-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 123390760 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 6-hydroxy-2-[2-phenyl-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid |
| SMILES | O=C(O)C(CCCCO)C(Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H20N4O3/c20-9-5-4-8-12(15(21)22)13(14-16-18-19-17-14)10-11-6-2-1-3-7-11/h1-3,6-7,12-13,20H,4-5,8-10H2,(H,21,22)(H,16,17,18,19) |
| InChIKey | KOSUZEMBUYKQBU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|