C13H17N5O3 — CID 118499847
2-[(1S)-2-(6-oxo-1H-pyridin-3-yl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 118499847) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[(1S)-2-(6-oxo-1H-pyridin-3-yl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | 2-[(1S)-2-(6-oxo-1H-pyridin-3-yl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 118499847 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[(1S)-2-(6-oxo-1H-pyridin-3-yl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)[C@H](Cc1ccc(=O)[nH]c1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H17N5O3/c1-2-3-9(13(20)21)10(12-15-17-18-16-12)6-8-4-5-11(19)14-7-8/h4-5,7,9-10H,2-3,6H2,1H3,(H,14,19)(H,20,21)(H,15,16,17,18)/t9?,10-/m0/s1 |
| InChIKey | VDSODTXZJRNVHZ-AXDSSHIGSA-N |
| XLogP | 0.72 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |