C19H21N5O2 — CID 123990328
2-[2-(3-pyridin-3-ylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 123990328) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[2-(3-pyridin-3-ylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | 2-[2-(3-pyridin-3-ylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 123990328 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[2-(3-pyridin-3-ylphenyl)-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(Cc1cccc(-c2cccnc2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C19H21N5O2/c1-2-5-16(19(25)26)17(18-21-23-24-22-18)11-13-6-3-7-14(10-13)15-8-4-9-20-12-15/h3-4,6-10,12,16-17H,2,5,11H2,1H3,(H,25,26)(H,21,22,23,24) |
| InChIKey | FOVHJNZLBHKDMU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |