C15H21N5O4 — CID 129264649
(2S)-2-[2-[6-(2-hydroxyethoxy)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 129264649) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2S)-2-[2-[6-(2-hydroxyethoxy)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-2-[2-[6-(2-hydroxyethoxy)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 129264649 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2S)-2-[2-[6-(2-hydroxyethoxy)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)C(Cc1ccc(OCCO)nc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H21N5O4/c1-2-3-11(15(22)23)12(14-17-19-20-18-14)8-10-4-5-13(16-9-10)24-7-6-21/h4-5,9,11-12,21H,2-3,6-8H2,1H3,(H,22,23)(H,17,18,19,20)/t11-,12?/m0/s1 |
| InChIKey | IQSRGUDOPCVTKV-PXYINDEMSA-N |
| XLogP | 0.79 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |