C20H31N6O2+ — CID 118499829
(2S)-2-[(1S)-2-[6-(1,1-dimethylpiperidin-1-ium-4-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 118499829) has the molecular formula C20H31N6O2+ and a molecular weight of 387.51 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[6-(1,1-dimethylpiperidin-1-ium-4-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[6-(1,1-dimethylpiperidin-1-ium-4-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 118499829 |
| Molecular Formula | C20H31N6O2+ |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (2S)-2-[(1S)-2-[6-(1,1-dimethylpiperidin-1-ium-4-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccc(C2CC[N+](C)(C)CC2)nc1)c1nn[nH]n1 |
| InChI | InChI=1S/C20H30N6O2/c1-4-5-16(20(27)28)17(19-22-24-25-23-19)12-14-6-7-18(21-13-14)15-8-10-26(2,3)11-9-15/h6-7,13,15-17H,4-5,8-12H2,1-3H3,(H-,22,23,24,25,27,28)/p+1/t16-,17-/m0/s1 |
| InChIKey | ZYXJGRYKHJMCPK-IRXDYDNUSA-O |
| XLogP | 2.38 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|