C14H18N4O2 — CID 118499935
(2R)-2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 118499935) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2R)-2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2R)-2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 118499935 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R)-2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCC[C@@H](C(=O)O)[C@H](Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H18N4O2/c1-2-6-11(14(19)20)12(13-15-17-18-16-13)9-10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3,(H,19,20)(H,15,16,17,18)/t11-,12+/m1/s1 |
| InChIKey | KCTDBULZTXFESV-NEPJUHHUSA-N |
| XLogP | 2.03 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |