C16H20N4O4 — CID 118499889
2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]heptanedioic acid (PubChem CID 118499889) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]heptanedioic acid.
| Compound Name | 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]heptanedioic acid |
|---|---|
| PubChem CID | 118499889 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]heptanedioic acid |
| SMILES | O=C(O)CCCCC(C(=O)O)[C@H](Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H20N4O4/c21-14(22)9-5-4-8-12(16(23)24)13(15-17-19-20-18-15)10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2,(H,21,22)(H,23,24)(H,17,18,19,20)/t12?,13-/m0/s1 |
| InChIKey | XJLCCVBKKIRGMI-ABLWVSNPSA-N |
| XLogP | 1.87 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|