C19H27N5O2 — CID 118499972
2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]-5-piperidin-4-ylpentanoic acid (PubChem CID 118499972) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]-5-piperidin-4-ylpentanoic acid.
| Compound Name | 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]-5-piperidin-4-ylpentanoic acid |
|---|---|
| PubChem CID | 118499972 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[(1S)-2-phenyl-1-(2H-tetrazol-5-yl)ethyl]-5-piperidin-4-ylpentanoic acid |
| SMILES | O=C(O)C(CCCC1CCNCC1)[C@H](Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C19H27N5O2/c25-19(26)16(8-4-7-14-9-11-20-12-10-14)17(18-21-23-24-22-18)13-15-5-2-1-3-6-15/h1-3,5-6,14,16-17,20H,4,7-13H2,(H,25,26)(H,21,22,23,24)/t16?,17-/m0/s1 |
| InChIKey | SPSRTCPJHXBRAJ-DJNXLDHESA-N |
| XLogP | 2.40 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |