C21H25N5O2 — CID 118506138
(2S)-2-[(1S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 118506138) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 118506138 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (2S)-2-[(1S)-2-[3-[3-(aminomethyl)phenyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1cccc(-c2cccc(CN)c2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C21H25N5O2/c1-2-5-18(21(27)28)19(20-23-25-26-24-20)12-14-6-3-8-16(10-14)17-9-4-7-15(11-17)13-22/h3-4,6-11,18-19H,2,5,12-13,22H2,1H3,(H,27,28)(H,23,24,25,26)/t18-,19-/m0/s1 |
| InChIKey | NGQJCQPLYOEALG-OALUTQOASA-N |
| XLogP | 3.15 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |