C31H31NO5 — CID 68696850
1-(3-carboxypropyl)-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indole-2-carboxylic acid (PubChem CID 68696850) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is 1-(3-carboxypropyl)-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indole-2-carboxylic acid.
| Compound Name | 1-(3-carboxypropyl)-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68696850 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 1-(3-carboxypropyl)-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indole-2-carboxylic acid |
| SMILES | O=C(O)CCCn1c(C(=O)O)cc2c(C=Cc3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H31NO5/c33-30(34)13-7-20-32-28-12-6-11-25(27(28)22-29(32)31(35)36)17-14-24-15-18-26(19-16-24)37-21-5-4-10-23-8-2-1-3-9-23/h1-3,6,8-9,11-12,14-19,22H,4-5,7,10,13,20-21H2,(H,33,34)(H,35,36) |
| InChIKey | PCCAUVRAKZHIMB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|