C38H39NO6 — CID 68690267
prop-2-enyl 4-oxo-4-[3-(2-oxo-2-prop-2-enoxyethyl)-4-[(E)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoate (PubChem CID 68690267) has the molecular formula C38H39NO6 and a molecular weight of 605.73 g/mol. Its IUPAC name is prop-2-enyl 4-oxo-4-[3-(2-oxo-2-prop-2-enoxyethyl)-4-[(E)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoate.
| Compound Name | prop-2-enyl 4-oxo-4-[3-(2-oxo-2-prop-2-enoxyethyl)-4-[(E)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 68690267 |
| Molecular Formula | C38H39NO6 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | prop-2-enyl 4-oxo-4-[3-(2-oxo-2-prop-2-enoxyethyl)-4-[(E)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoate |
| SMILES | C=CCOC(=O)CCC(=O)n1cc(CC(=O)OCC=C)c2c(/C=C/c3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C38H39NO6/c1-3-24-44-36(41)23-22-35(40)39-28-32(27-37(42)45-25-4-2)38-31(14-10-15-34(38)39)19-16-30-17-20-33(21-18-30)43-26-9-8-13-29-11-6-5-7-12-29/h3-7,10-12,14-21,28H,1-2,8-9,13,22-27H2/b19-16+ |
| InChIKey | JIXCXRIHLXDZRB-KNTRCKAVSA-N |
| XLogP | 7.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|