C22H19NO5 — CID 89318775
4-[3-(carboxymethyl)-4-[(E)-2-phenylethenyl]indol-1-yl]-4-oxobutanoic acid (PubChem CID 89318775) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-phenylethenyl]indol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-phenylethenyl]indol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89318775 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-phenylethenyl]indol-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)n1cc(CC(=O)O)c2c(/C=C/c3ccccc3)cccc21 |
| InChI | InChI=1S/C22H19NO5/c24-19(11-12-20(25)26)23-14-17(13-21(27)28)22-16(7-4-8-18(22)23)10-9-15-5-2-1-3-6-15/h1-10,14H,11-13H2,(H,25,26)(H,27,28)/b10-9+ |
| InChIKey | KVGOSYJODJONLS-MDZDMXLPSA-N |
| XLogP | 3.94 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|