C13H16BrNO — CID 170489715
N-[4-[3-(bromomethyl)phenyl]but-3-enyl]acetamide (PubChem CID 170489715) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is N-[4-[3-(bromomethyl)phenyl]but-3-enyl]acetamide.
| Compound Name | N-[4-[3-(bromomethyl)phenyl]but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489715 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-[4-[3-(bromomethyl)phenyl]but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cccc(CBr)c1 |
| InChI | InChI=1S/C13H16BrNO/c1-11(16)15-8-3-2-5-12-6-4-7-13(9-12)10-14/h2,4-7,9H,3,8,10H2,1H3,(H,15,16) |
| InChIKey | XNNSBJFPRWWCKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|