C19H16Br2O — CID 77385937
1,5-bis[3-(bromomethyl)phenyl]penta-1,4-dien-3-one (PubChem CID 77385937) has the molecular formula C19H16Br2O and a molecular weight of 420.14 g/mol. Its IUPAC name is 1,5-bis[3-(bromomethyl)phenyl]penta-1,4-dien-3-one.
| Compound Name | 1,5-bis[3-(bromomethyl)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 77385937 |
| Molecular Formula | C19H16Br2O |
| Molecular Weight | 420.14 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 1,5-bis[3-(bromomethyl)phenyl]penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1cccc(CBr)c1)C=Cc1cccc(CBr)c1 |
| InChI | InChI=1S/C19H16Br2O/c20-13-17-5-1-3-15(11-17)7-9-19(22)10-8-16-4-2-6-18(12-16)14-21/h1-12H,13-14H2 |
| InChIKey | VLUQHFRXARLLOW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.14 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|