C13H14F3NO — CID 170496577
2,2,2-trifluoro-1-[3-[4-(methylamino)but-1-enyl]phenyl]ethanone (PubChem CID 170496577) has the molecular formula C13H14F3NO and a molecular weight of 257.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-[4-(methylamino)but-1-enyl]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-[4-(methylamino)but-1-enyl]phenyl]ethanone |
|---|---|
| PubChem CID | 170496577 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-[4-(methylamino)but-1-enyl]phenyl]ethanone |
| SMILES | CNCCC=Cc1cccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO/c1-17-8-3-2-5-10-6-4-7-11(9-10)12(18)13(14,15)16/h2,4-7,9,17H,3,8H2,1H3 |
| InChIKey | PVDQSVDEWDVXGU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|