C11H13N3O4 — CID 171899382
4-(3-amino-1,2-benzoxazol-5-yl)-3,4-dihydroxybutanamide (PubChem CID 171899382) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 4-(3-amino-1,2-benzoxazol-5-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(3-amino-1,2-benzoxazol-5-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899382 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-(3-amino-1,2-benzoxazol-5-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc2onc(N)c2c1 |
| InChI | InChI=1S/C11H13N3O4/c12-9(16)4-7(15)10(17)5-1-2-8-6(3-5)11(13)14-18-8/h1-3,7,10,15,17H,4H2,(H2,12,16)(H2,13,14) |
| InChIKey | BIQIPGPKFMRNCA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |