C10H12N2O3S — CID 170820084
1-(3-amino-1,2-benzoxazol-5-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820084) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-(3-amino-1,2-benzoxazol-5-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(3-amino-1,2-benzoxazol-5-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820084 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-(3-amino-1,2-benzoxazol-5-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Nc1noc2ccc(C(O)C(O)CS)cc12 |
| InChI | InChI=1S/C10H12N2O3S/c11-10-6-3-5(9(14)7(13)4-16)1-2-8(6)15-12-10/h1-3,7,9,13-14,16H,4H2,(H2,11,12) |
| InChIKey | URQWAJORFOJODI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|