C11H15N3O3 — CID 171881465
4-amino-1-(3-amino-1,2-benzoxazol-5-yl)butane-1,2-diol (PubChem CID 171881465) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-amino-1-(3-amino-1,2-benzoxazol-5-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(3-amino-1,2-benzoxazol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881465 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-amino-1-(3-amino-1,2-benzoxazol-5-yl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc2onc(N)c2c1 |
| InChI | InChI=1S/C11H15N3O3/c12-4-3-8(15)10(16)6-1-2-9-7(5-6)11(13)14-17-9/h1-2,5,8,10,15-16H,3-4,12H2,(H2,13,14) |
| InChIKey | GFOHOVXXGSZDNP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |