C12H16N2O3 — CID 171881491
4-amino-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,2-diol (PubChem CID 171881491) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-amino-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881491 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-amino-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,2-diol |
| SMILES | Cc1nc2cc(C(O)C(O)CCN)ccc2o1 |
| InChI | InChI=1S/C12H16N2O3/c1-7-14-9-6-8(2-3-11(9)17-7)12(16)10(15)4-5-13/h2-3,6,10,12,15-16H,4-5,13H2,1H3 |
| InChIKey | POMZEWKVUNOZDI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |