C13H19N3O — CID 116934225
3-methyl-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,4-diamine (PubChem CID 116934225) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-methyl-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,4-diamine.
| Compound Name | 3-methyl-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116934225 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-methyl-1-(2-methyl-1,3-benzoxazol-5-yl)butane-1,4-diamine |
| SMILES | Cc1nc2cc(C(N)CC(C)CN)ccc2o1 |
| InChI | InChI=1S/C13H19N3O/c1-8(7-14)5-11(15)10-3-4-13-12(6-10)16-9(2)17-13/h3-4,6,8,11H,5,7,14-15H2,1-2H3 |
| InChIKey | PQBDRAMJPAXTTG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |