C9H12N4O — CID 116947497
hydrazinyl-(2-methyl-1,3-benzoxazol-5-yl)methanamine (PubChem CID 116947497) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is hydrazinyl-(2-methyl-1,3-benzoxazol-5-yl)methanamine.
| Compound Name | hydrazinyl-(2-methyl-1,3-benzoxazol-5-yl)methanamine |
|---|---|
| PubChem CID | 116947497 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | hydrazinyl-(2-methyl-1,3-benzoxazol-5-yl)methanamine |
| SMILES | Cc1nc2cc(C(N)NN)ccc2o1 |
| InChI | InChI=1S/C9H12N4O/c1-5-12-7-4-6(9(10)13-11)2-3-8(7)14-5/h2-4,9,13H,10-11H2,1H3 |
| InChIKey | SPURLDUHGIZXEI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|