C12H17N3O — CID 116909296
N,N',N'-trimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)methanediamine (PubChem CID 116909296) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N,N',N'-trimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)methanediamine.
| Compound Name | N,N',N'-trimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)methanediamine |
|---|---|
| PubChem CID | 116909296 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N,N',N'-trimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)methanediamine |
| SMILES | CNC(c1ccc2oc(C)nc2c1)N(C)C |
| InChI | InChI=1S/C12H17N3O/c1-8-14-10-7-9(5-6-11(10)16-8)12(13-2)15(3)4/h5-7,12-13H,1-4H3 |
| InChIKey | YIVIFADHMHWWNY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|