C10H13N3O — CID 116939357
N'-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)methanediamine (PubChem CID 116939357) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N'-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)methanediamine.
| Compound Name | N'-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)methanediamine |
|---|---|
| PubChem CID | 116939357 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N'-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)methanediamine |
| SMILES | CNC(N)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C10H13N3O/c1-6-13-8-4-3-7(10(11)12-2)5-9(8)14-6/h3-5,10,12H,11H2,1-2H3 |
| InChIKey | KVRFLEDVYXEMPC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|