C13H18N2O — CID 82493621
3-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)butan-1-amine (PubChem CID 82493621) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)butan-1-amine.
| Compound Name | 3-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)butan-1-amine |
|---|---|
| PubChem CID | 82493621 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-methyl-1-(2-methyl-1,3-benzoxazol-6-yl)butan-1-amine |
| SMILES | Cc1nc2ccc(C(N)CC(C)C)cc2o1 |
| InChI | InChI=1S/C13H18N2O/c1-8(2)6-11(14)10-4-5-12-13(7-10)16-9(3)15-12/h4-5,7-8,11H,6,14H2,1-3H3 |
| InChIKey | GQURDLBXUYOZKN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |