C10H10BrNO2 — CID 116863243
2-bromo-1-(2-methyl-1,3-benzoxazol-6-yl)ethanol (PubChem CID 116863243) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 2-bromo-1-(2-methyl-1,3-benzoxazol-6-yl)ethanol.
| Compound Name | 2-bromo-1-(2-methyl-1,3-benzoxazol-6-yl)ethanol |
|---|---|
| PubChem CID | 116863243 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-bromo-1-(2-methyl-1,3-benzoxazol-6-yl)ethanol |
| SMILES | Cc1nc2ccc(C(O)CBr)cc2o1 |
| InChI | InChI=1S/C10H10BrNO2/c1-6-12-8-3-2-7(9(13)5-11)4-10(8)14-6/h2-4,9,13H,5H2,1H3 |
| InChIKey | NGBQVLPPONJWII-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|