C11H12ClNO2 — CID 116863715
2-chloro-1-(2-methyl-1,3-benzoxazol-6-yl)propan-1-ol (PubChem CID 116863715) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 2-chloro-1-(2-methyl-1,3-benzoxazol-6-yl)propan-1-ol.
| Compound Name | 2-chloro-1-(2-methyl-1,3-benzoxazol-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 116863715 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-chloro-1-(2-methyl-1,3-benzoxazol-6-yl)propan-1-ol |
| SMILES | Cc1nc2ccc(C(O)C(C)Cl)cc2o1 |
| InChI | InChI=1S/C11H12ClNO2/c1-6(12)11(14)8-3-4-9-10(5-8)15-7(2)13-9/h3-6,11,14H,1-2H3 |
| InChIKey | VFXVQWPBAZWLNU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|