C11H12N2O2 — CID 116954230
2-(methylamino)-2-(2-methyl-1,3-benzoxazol-5-yl)acetaldehyde (PubChem CID 116954230) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(methylamino)-2-(2-methyl-1,3-benzoxazol-5-yl)acetaldehyde.
| Compound Name | 2-(methylamino)-2-(2-methyl-1,3-benzoxazol-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 116954230 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-(methylamino)-2-(2-methyl-1,3-benzoxazol-5-yl)acetaldehyde |
| SMILES | CNC(C=O)c1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-13-9-5-8(10(6-14)12-2)3-4-11(9)15-7/h3-6,10,12H,1-2H3 |
| InChIKey | BNGYNEMESCZGTM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|