C9H10N2OS — CID 116939524
amino-(2-methyl-1,3-benzoxazol-5-yl)methanethiol (PubChem CID 116939524) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is amino-(2-methyl-1,3-benzoxazol-5-yl)methanethiol.
| Compound Name | amino-(2-methyl-1,3-benzoxazol-5-yl)methanethiol |
|---|---|
| PubChem CID | 116939524 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | amino-(2-methyl-1,3-benzoxazol-5-yl)methanethiol |
| SMILES | Cc1nc2cc(C(N)S)ccc2o1 |
| InChI | InChI=1S/C9H10N2OS/c1-5-11-7-4-6(9(10)13)2-3-8(7)12-5/h2-4,9,13H,10H2,1H3 |
| InChIKey | AOALJJAVIBOVSO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|