C12H16N2O2 — CID 116835654
3-methoxy-2-(2-methyl-1,3-benzoxazol-5-yl)propan-1-amine (PubChem CID 116835654) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-methoxy-2-(2-methyl-1,3-benzoxazol-5-yl)propan-1-amine.
| Compound Name | 3-methoxy-2-(2-methyl-1,3-benzoxazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 116835654 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-methoxy-2-(2-methyl-1,3-benzoxazol-5-yl)propan-1-amine |
| SMILES | COCC(CN)c1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C12H16N2O2/c1-8-14-11-5-9(3-4-12(11)16-8)10(6-13)7-15-2/h3-5,10H,6-7,13H2,1-2H3 |
| InChIKey | QNAOYXLUEZNGHP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |