C12H15N3O3 — CID 116942843
3,4-diamino-4-(2-methyl-1,3-benzoxazol-5-yl)butanoic acid (PubChem CID 116942843) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3,4-diamino-4-(2-methyl-1,3-benzoxazol-5-yl)butanoic acid.
| Compound Name | 3,4-diamino-4-(2-methyl-1,3-benzoxazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 116942843 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3,4-diamino-4-(2-methyl-1,3-benzoxazol-5-yl)butanoic acid |
| SMILES | Cc1nc2cc(C(N)C(N)CC(=O)O)ccc2o1 |
| InChI | InChI=1S/C12H15N3O3/c1-6-15-9-4-7(2-3-10(9)18-6)12(14)8(13)5-11(16)17/h2-4,8,12H,5,13-14H2,1H3,(H,16,17) |
| InChIKey | GFHQMTBKKYQKLL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |