C12H16N4O2 — CID 116942840
3,4-diamino-4-(2-methyl-3H-benzimidazol-5-yl)butanoic acid (PubChem CID 116942840) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3,4-diamino-4-(2-methyl-3H-benzimidazol-5-yl)butanoic acid.
| Compound Name | 3,4-diamino-4-(2-methyl-3H-benzimidazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 116942840 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3,4-diamino-4-(2-methyl-3H-benzimidazol-5-yl)butanoic acid |
| SMILES | Cc1nc2ccc(C(N)C(N)CC(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C12H16N4O2/c1-6-15-9-3-2-7(4-10(9)16-6)12(14)8(13)5-11(17)18/h2-4,8,12H,5,13-14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | JDLGBPYZSREEDA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |